C28H25NO2 — CID 126816992
1-(2,7-dimethyl-4-phenylquinolin-3-yl)-3-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 126816992) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-(2,7-dimethyl-4-phenylquinolin-3-yl)-3-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,7-dimethyl-4-phenylquinolin-3-yl)-3-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126816992 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1-(2,7-dimethyl-4-phenylquinolin-3-yl)-3-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C=CC(=O)c2c(C)nc3cc(C)ccc3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO2/c1-4-31-23-14-11-21(12-15-23)13-17-26(30)27-20(3)29-25-18-19(2)10-16-24(25)28(27)22-8-6-5-7-9-22/h5-18H,4H2,1-3H3 |
| InChIKey | IYQUUHVCLODNLL-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|