C28H21N3O — CID 71916499
1-(2,6-dimethyl-4-phenylquinolin-3-yl)-3-quinoxalin-5-ylprop-2-en-1-one (PubChem CID 71916499) has the molecular formula C28H21N3O and a molecular weight of 415.50 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-phenylquinolin-3-yl)-3-quinoxalin-5-ylprop-2-en-1-one.
| Compound Name | 1-(2,6-dimethyl-4-phenylquinolin-3-yl)-3-quinoxalin-5-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71916499 |
| Molecular Formula | C28H21N3O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-(2,6-dimethyl-4-phenylquinolin-3-yl)-3-quinoxalin-5-ylprop-2-en-1-one |
| SMILES | Cc1ccc2nc(C)c(C(=O)C=Cc3cccc4nccnc34)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C28H21N3O/c1-18-11-13-23-22(17-18)27(20-7-4-3-5-8-20)26(19(2)31-23)25(32)14-12-21-9-6-10-24-28(21)30-16-15-29-24/h3-17H,1-2H3 |
| InChIKey | PFZGGEXPAHXHIE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|