C20H14N2O6S — CID 3386349
4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 3386349) has the molecular formula C20H14N2O6S and a molecular weight of 410.41 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3386349 |
| Molecular Formula | C20H14N2O6S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(furan-2-yl)-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nccs2)C(c2ccco2)C1=C(O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H14N2O6S/c23-17(11-3-4-12-14(10-11)28-8-7-27-12)15-16(13-2-1-6-26-13)22(19(25)18(15)24)20-21-5-9-29-20/h1-6,9-10,16,23H,7-8H2 |
| InChIKey | DYSBFMBHNQCWFX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|