C23H17BrN2O7S — CID 3386458
5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 3386458) has the molecular formula C23H17BrN2O7S and a molecular weight of 545.37 g/mol. Its IUPAC name is 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3386458 |
| Molecular Formula | C23H17BrN2O7S |
| Molecular Weight | 545.37 g/mol |
| Exact Mass | 543.99 |
| IUPAC Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2nccs2)cc(Br)c1O |
| InChI | InChI=1S/C23H17BrN2O7S/c1-31-16-10-12(8-13(24)20(16)28)18-17(21(29)22(30)26(18)23-25-4-7-34-23)19(27)11-2-3-14-15(9-11)33-6-5-32-14/h2-4,7-10,18,27-28H,5-6H2,1H3 |
| InChIKey | QTPVWVOBHWIOHS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|