C20H14BrN3O5S — CID 6298622
(4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 6298622) has the molecular formula C20H14BrN3O5S and a molecular weight of 488.32 g/mol. Its IUPAC name is (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6298622 |
| Molecular Formula | C20H14BrN3O5S |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3ccncc3)C(=O)C(=O)N2c2nccs2)cc(Br)c1O |
| InChI | InChI=1S/C20H14BrN3O5S/c1-29-13-9-11(8-12(21)17(13)26)15-14(16(25)10-2-4-22-5-3-10)18(27)19(28)24(15)20-23-6-7-30-20/h2-9,15,25-26H,1H3/b16-14+ |
| InChIKey | ARJSPKZVCDZFIM-JQIJEIRASA-N |
| XLogP | 3.64 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|