C26H20BrN3O5S — CID 6299135
(4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6299135) has the molecular formula C26H20BrN3O5S and a molecular weight of 566.43 g/mol. Its IUPAC name is (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6299135 |
| Molecular Formula | C26H20BrN3O5S |
| Molecular Weight | 566.43 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3ccncc3)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc(Br)c1O |
| InChI | InChI=1S/C26H20BrN3O5S/c1-12-8-13(2)20-18(9-12)36-26(29-20)30-21(15-10-16(27)23(32)17(11-15)35-3)19(24(33)25(30)34)22(31)14-4-6-28-7-5-14/h4-11,21,31-32H,1-3H3/b22-19+ |
| InChIKey | YNLPBNSNFZOMSM-ZBJSNUHESA-N |
| XLogP | 5.41 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|