C31H31N3O5S — CID 6296699
(4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 6296699) has the molecular formula C31H31N3O5S and a molecular weight of 557.67 g/mol. Its IUPAC name is (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6296699 |
| Molecular Formula | C31H31N3O5S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]-5-[3-methoxy-4-(3-methylbutoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3ccncc3)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)ccc1OCCC(C)C |
| InChI | InChI=1S/C31H31N3O5S/c1-17(2)10-13-39-22-7-6-21(16-23(22)38-5)27-25(28(35)20-8-11-32-12-9-20)29(36)30(37)34(27)31-33-26-19(4)14-18(3)15-24(26)40-31/h6-9,11-12,14-17,27,35H,10,13H2,1-5H3/b28-25+ |
| InChIKey | ZKBNZLBWONHVDE-AZPGRJICSA-N |
| XLogP | 6.37 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|