C27H23N3O5S — CID 5163897
5-(3,4-dimethoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 5163897) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5163897 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(pyridin-4-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2C(=C(O)c3ccncc3)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1OC |
| InChI | InChI=1S/C27H23N3O5S/c1-14-11-15(2)22-20(12-14)36-27(29-22)30-23(17-5-6-18(34-3)19(13-17)35-4)21(25(32)26(30)33)24(31)16-7-9-28-10-8-16/h5-13,23,31H,1-4H3 |
| InChIKey | ARDABKCOUGTRRB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|