C33H34N2O6S — CID 6167938
(4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6167938) has the molecular formula C33H34N2O6S and a molecular weight of 586.71 g/mol. Its IUPAC name is (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6167938 |
| Molecular Formula | C33H34N2O6S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | (4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1OC |
| InChI | InChI=1S/C33H34N2O6S/c1-6-7-8-15-41-24-14-11-22(18-25(24)40-5)29-27(30(36)21-9-12-23(39-4)13-10-21)31(37)32(38)35(29)33-34-28-20(3)16-19(2)17-26(28)42-33/h9-14,16-18,29,36H,6-8,15H2,1-5H3/b30-27+ |
| InChIKey | MHJOBFDFURRHRO-KDJFERLWSA-N |
| XLogP | 7.13 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|