C34H28N2O5S — CID 3504287
1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 3504287) has the molecular formula C34H28N2O5S and a molecular weight of 576.67 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3504287 |
| Molecular Formula | C34H28N2O5S |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccccc3)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H28N2O5S/c1-20-16-21(2)29-27(17-20)42-34(35-29)36-30(28(32(38)33(36)39)31(37)23-12-8-5-9-13-23)24-14-15-25(26(18-24)40-3)41-19-22-10-6-4-7-11-22/h4-18,30,37H,19H2,1-3H3 |
| InChIKey | QSHNYTNWSCSBMB-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|