C24H20ClNO3S — CID 3386853
[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 3386853) has the molecular formula C24H20ClNO3S and a molecular weight of 437.95 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3386853 |
| Molecular Formula | C24H20ClNO3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | [2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)c3sc4ccccc4c3Cl)c2C)cc1 |
| InChI | InChI=1S/C24H20ClNO3S/c1-14-8-10-17(11-9-14)26-15(2)12-19(16(26)3)20(27)13-29-24(28)23-22(25)18-6-4-5-7-21(18)30-23/h4-12H,13H2,1-3H3 |
| InChIKey | WJQMHWBVOAHIFY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|