C19H21N3O3S — CID 3388041
N-[(5-methoxy-1,2-dimethylindol-3-yl)methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 3388041) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[(5-methoxy-1,2-dimethylindol-3-yl)methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(5-methoxy-1,2-dimethylindol-3-yl)methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3388041 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[(5-methoxy-1,2-dimethylindol-3-yl)methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc2c(c1)c(C=NNS(=O)(=O)c1ccc(C)cc1)c(C)n2C |
| InChI | InChI=1S/C19H21N3O3S/c1-13-5-8-16(9-6-13)26(23,24)21-20-12-18-14(2)22(3)19-10-7-15(25-4)11-17(18)19/h5-12,21H,1-4H3 |
| InChIKey | UTIBTSKMFASDLI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|