C21H24N2O3S2 — CID 3392108
3-(furan-2-ylmethyl)-2-(oxan-2-ylmethylsulfanyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3392108) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-(oxan-2-ylmethylsulfanyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-2-(oxan-2-ylmethylsulfanyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3392108 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-(oxan-2-ylmethylsulfanyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c3c(sc2nc(SCC2CCCCO2)n1Cc1ccco1)CCCC3 |
| InChI | InChI=1S/C21H24N2O3S2/c24-20-18-16-8-1-2-9-17(16)28-19(18)22-21(23(20)12-14-7-5-11-25-14)27-13-15-6-3-4-10-26-15/h5,7,11,15H,1-4,6,8-10,12-13H2 |
| InChIKey | FSTRAWVFTINFNI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_65_pyridone_A(3)', 'substructure': 'N/A'} |
|---|