C19H22N2O3S2 — CID 7953827
2-(2-ethoxyethylsulfanyl)-3-(furan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7953827) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-(2-ethoxyethylsulfanyl)-3-(furan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-ethoxyethylsulfanyl)-3-(furan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7953827 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-(2-ethoxyethylsulfanyl)-3-(furan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCOCCSc1nc2sc3c(c2c(=O)n1Cc1ccco1)CCCC3 |
| InChI | InChI=1S/C19H22N2O3S2/c1-2-23-10-11-25-19-20-17-16(14-7-3-4-8-15(14)26-17)18(22)21(19)12-13-6-5-9-24-13/h5-6,9H,2-4,7-8,10-12H2,1H3 |
| InChIKey | ZUSXDKMGFVFEQV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_65_pyridone_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|