C18H24N2O5 — CID 33926
Barbituric acid, 1,3-bis(ethoxymethyl)-5-ethyl-5-phenyl- (PubChem CID 33926) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1,3-bis(ethoxymethyl)-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | Barbituric acid, 1,3-bis(ethoxymethyl)-5-ethyl-5-phenyl- |
|---|---|
| PubChem CID | 33926 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1,3-bis(ethoxymethyl)-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(C(=O)N(C(=O)N(C1=O)COCC)COCC)C2=CC=CC=C2 |
| InChI | InChI=1S/C18H24N2O5/c1-4-18(14-10-8-7-9-11-14)15(21)19(12-24-5-2)17(23)20(16(18)22)13-25-6-3/h7-11H,4-6,12-13H2,1-3H3 |
| InChIKey | INJMAFDBGNBDKD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | 472 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|