C12H14N2O2 — CID 4909
View drug profile → primidone5-ethyl-5-phenyl-1,3-diazinane-4,6-dione (PubChem CID 4909) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-ethyl-5-phenyl-1,3-diazinane-4,6-dione.
| Compound Name | 5-ethyl-5-phenyl-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 4909 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 5-ethyl-5-phenyl-1,3-diazinane-4,6-dione |
| SMILES | CCC1(c2ccccc2)C(=O)NCNC1=O |
| InChI | InChI=1S/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | DQMZLTXERSFNPB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|