C27H25N3O7S — CID 3396686
2-methylpropyl 5-(4-methoxycarbonylphenyl)-7-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3396686) has the molecular formula C27H25N3O7S and a molecular weight of 535.58 g/mol. Its IUPAC name is 2-methylpropyl 5-(4-methoxycarbonylphenyl)-7-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methylpropyl 5-(4-methoxycarbonylphenyl)-7-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3396686 |
| Molecular Formula | C27H25N3O7S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 2-methylpropyl 5-(4-methoxycarbonylphenyl)-7-methyl-2-[(2-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)c1ccc(C2C(C(=O)OCC(C)C)=C(C)N=c3sc(=Cc4ccccc4[N+](=O)[O-])c(=O)n32)cc1 |
| InChI | InChI=1S/C27H25N3O7S/c1-15(2)14-37-26(33)22-16(3)28-27-29(23(22)17-9-11-18(12-10-17)25(32)36-4)24(31)21(38-27)13-19-7-5-6-8-20(19)30(34)35/h5-13,15,23H,14H2,1-4H3 |
| InChIKey | IUJOFSKRFSHACQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 130.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|