C26H24ClN3O2S — CID 3398716
N-(4-chlorophenyl)-10-(2,3-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide (PubChem CID 3398716) has the molecular formula C26H24ClN3O2S and a molecular weight of 478.02 g/mol. Its IUPAC name is N-(4-chlorophenyl)-10-(2,3-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide.
| Compound Name | N-(4-chlorophenyl)-10-(2,3-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide |
|---|---|
| PubChem CID | 3398716 |
| Molecular Formula | C26H24ClN3O2S |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-(4-chlorophenyl)-10-(2,3-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide |
| SMILES | Cc1cccc(N2C(=S)NC3c4ccccc4OC2(C)C3C(=O)Nc2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C26H24ClN3O2S/c1-15-7-6-9-20(16(15)2)30-25(33)29-23-19-8-4-5-10-21(19)32-26(30,3)22(23)24(31)28-18-13-11-17(27)12-14-18/h4-14,22-23H,1-3H3,(H,28,31)(H,29,33) |
| InChIKey | HSQFKDQOPASRGA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|