C14H15NO4 — CID 3400759
2,2-dimethyl-5-[(2-methylanilino)methylidene]-1,3-dioxane-4,6-dione (PubChem CID 3400759) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(2-methylanilino)methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(2-methylanilino)methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 3400759 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2,2-dimethyl-5-[(2-methylanilino)methylidene]-1,3-dioxane-4,6-dione |
| SMILES | Cc1ccccc1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C14H15NO4/c1-9-6-4-5-7-11(9)15-8-10-12(16)18-14(2,3)19-13(10)17/h4-8,15H,1-3H3 |
| InChIKey | SVLVTOKDVXFORE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|