C17H13F5N2O — CID 34008980
2-(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 34008980) has the molecular formula C17H13F5N2O and a molecular weight of 356.29 g/mol. Its IUPAC name is 2-(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 34008980 |
| Molecular Formula | C17H13F5N2O |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-(6,8-difluoro-3,4-dihydro-2H-quinolin-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1CCCc2cc(F)cc(F)c21)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F5N2O/c18-10-6-9-2-1-5-24(17(9)12(20)7-10)8-14(25)23-13-4-3-11(19)15(21)16(13)22/h3-4,6-7H,1-2,5,8H2,(H,23,25) |
| InChIKey | VPXGAOQUVQGSIJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|