C20H19F4N3O2 — CID 37383606
2-[[2-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 37383606) has the molecular formula C20H19F4N3O2 and a molecular weight of 409.38 g/mol. Its IUPAC name is 2-[[2-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 37383606 |
| Molecular Formula | C20H19F4N3O2 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-[[2-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1cc(F)c2c(c1)CCCN2CC(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H19F4N3O2/c1-11-7-12-3-2-6-27(20(12)14(22)8-11)10-17(29)25-9-16(28)26-15-5-4-13(21)18(23)19(15)24/h4-5,7-8H,2-3,6,9-10H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | STOSHMSFEQXGRJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|