C18H18FN3O3 — CID 37383481
2-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)-N-(2-nitrophenyl)acetamide (PubChem CID 37383481) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 37383481 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-(8-fluoro-6-methyl-3,4-dihydro-2H-quinolin-1-yl)-N-(2-nitrophenyl)acetamide |
| SMILES | Cc1cc(F)c2c(c1)CCCN2CC(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18FN3O3/c1-12-9-13-5-4-8-21(18(13)14(19)10-12)11-17(23)20-15-6-2-3-7-16(15)22(24)25/h2-3,6-7,9-10H,4-5,8,11H2,1H3,(H,20,23) |
| InChIKey | HLZPXJRWVDECIC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|