C13H12F12N2NiO2+2 — CID 3401791
[1,1,1,5,5,5-hexafluoro-4-[1-[(1,1,1,5,5,5-hexafluoro-4-oxoniumylidenepentan-2-ylidene)amino]propan-2-ylimino]pentan-2-ylidene]oxidanium;nickel (PubChem CID 3401791) has the molecular formula C13H12F12N2NiO2+2 and a molecular weight of 514.92 g/mol. Its IUPAC name is [1,1,1,5,5,5-hexafluoro-4-[1-[(1,1,1,5,5,5-hexafluoro-4-oxoniumylidenepentan-2-ylidene)amino]propan-2-ylimino]pentan-2-ylidene]oxidanium;nickel.
| Compound Name | [1,1,1,5,5,5-hexafluoro-4-[1-[(1,1,1,5,5,5-hexafluoro-4-oxoniumylidenepentan-2-ylidene)amino]propan-2-ylimino]pentan-2-ylidene]oxidanium;nickel |
|---|---|
| PubChem CID | 3401791 |
| Molecular Formula | C13H12F12N2NiO2+2 |
| Molecular Weight | 514.92 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | [1,1,1,5,5,5-hexafluoro-4-[1-[(1,1,1,5,5,5-hexafluoro-4-oxoniumylidenepentan-2-ylidene)amino]propan-2-ylimino]pentan-2-ylidene]oxidanium;nickel |
| SMILES | [H]/[O+]=C(/C/C(=N/CC(C)/N=C(/C/C(=[O+]/[H])C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F.[Ni] |
| InChI | InChI=1S/C13H10F12N2O2.Ni/c1-5(27-7(11(17,18)19)3-9(29)13(23,24)25)4-26-6(10(14,15)16)2-8(28)12(20,21)22;/h5H,2-4H2,1H3;/p+2/b26-6-,27-7-; |
| InChIKey | YJFPROMABRMFEW-DLGNZIGKSA-P |
| XLogP | 4.37 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|