C12H16CuF6N2O2+2 — CID 4522960
copper;[1,1,1-trifluoro-4-[2-[(5,5,5-trifluoro-4-oxoniumylidenepentan-2-ylidene)amino]ethylimino]pentan-2-ylidene]oxidanium (PubChem CID 4522960) has the molecular formula C12H16CuF6N2O2+2 and a molecular weight of 397.81 g/mol. Its IUPAC name is copper;[1,1,1-trifluoro-4-[2-[(5,5,5-trifluoro-4-oxoniumylidenepentan-2-ylidene)amino]ethylimino]pentan-2-ylidene]oxidanium.
| Compound Name | copper;[1,1,1-trifluoro-4-[2-[(5,5,5-trifluoro-4-oxoniumylidenepentan-2-ylidene)amino]ethylimino]pentan-2-ylidene]oxidanium |
|---|---|
| PubChem CID | 4522960 |
| Molecular Formula | C12H16CuF6N2O2+2 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | copper;[1,1,1-trifluoro-4-[2-[(5,5,5-trifluoro-4-oxoniumylidenepentan-2-ylidene)amino]ethylimino]pentan-2-ylidene]oxidanium |
| SMILES | [Cu].[H]/[O+]=C(/C/C(C)=N/CC/N=C(\C)C/C(=[O+]/[H])C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6N2O2.Cu/c1-7(5-9(21)11(13,14)15)19-3-4-20-8(2)6-10(22)12(16,17)18;/h3-6H2,1-2H3;/p+2/b19-7+,20-8+; |
| InChIKey | UNNDDVPRTFWSJR-XKSVKDSASA-P |
| XLogP | 2.90 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|