C12H20CuN2O2 — CID 409582
N,N'-Ethylenebis(acetylacetoniminato)copper(II) (PubChem CID 409582) has the molecular formula C12H20CuN2O2 and a molecular weight of 287.85 g/mol. Its IUPAC name is copper;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one.
| Compound Name | N,N'-Ethylenebis(acetylacetoniminato)copper(II) |
|---|---|
| PubChem CID | 409582 |
| Molecular Formula | C12H20CuN2O2 |
| Molecular Weight | 287.85 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | copper;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one |
| SMILES | CC(=NCCN=C(C)CC(=O)C)CC(=O)C.[Cu] |
| InChI | InChI=1S/C12H20N2O2.Cu/c1-9(7-11(3)15)13-5-6-14-10(2)8-12(4)16;/h5-8H2,1-4H3; |
| InChIKey | FKIMHHDMSZFPDR-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 58.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | 290 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|