C25H34N4O3S2 — CID 3401937
5-[[2-(3-ethoxypropylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-heptyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3401937) has the molecular formula C25H34N4O3S2 and a molecular weight of 502.71 g/mol. Its IUPAC name is 5-[[2-(3-ethoxypropylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-heptyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-(3-ethoxypropylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-heptyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3401937 |
| Molecular Formula | C25H34N4O3S2 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 5-[[2-(3-ethoxypropylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-heptyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCN1C(=O)C(=Cc2c(NCCCOCC)nc3c(C)cccn3c2=O)SC1=S |
| InChI | InChI=1S/C25H34N4O3S2/c1-4-6-7-8-9-14-29-24(31)20(34-25(29)33)17-19-21(26-13-11-16-32-5-2)27-22-18(3)12-10-15-28(22)23(19)30/h10,12,15,17,26H,4-9,11,13-14,16H2,1-3H3 |
| InChIKey | OILFHXZKTJSRPT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|