C25H25ClN4O3S2 — CID 6154835
(5Z)-3-[(2-chlorophenyl)methyl]-5-[[2-(3-ethoxypropylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6154835) has the molecular formula C25H25ClN4O3S2 and a molecular weight of 529.09 g/mol. Its IUPAC name is (5Z)-3-[(2-chlorophenyl)methyl]-5-[[2-(3-ethoxypropylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(2-chlorophenyl)methyl]-5-[[2-(3-ethoxypropylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6154835 |
| Molecular Formula | C25H25ClN4O3S2 |
| Molecular Weight | 529.09 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (5Z)-3-[(2-chlorophenyl)methyl]-5-[[2-(3-ethoxypropylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOCCCNc1nc2c(C)cccn2c(=O)c1/C=C1\SC(=S)N(Cc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C25H25ClN4O3S2/c1-3-33-13-7-11-27-21-18(23(31)29-12-6-8-16(2)22(29)28-21)14-20-24(32)30(25(34)35-20)15-17-9-4-5-10-19(17)26/h4-6,8-10,12,14,27H,3,7,11,13,15H2,1-2H3/b20-14- |
| InChIKey | WMRJSVCSLODRBS-ZHZULCJRSA-N |
| XLogP | 4.90 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.09 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|