About 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine
2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine (PubChem CID 3401968) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine |
| PubChem CID | 3401968 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(-n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C11H14N4/c1-7-5-8(2)13-11(12-7)15-10(4)6-9(3)14-15/h5-6H,1-4H3 |
| InChIKey | HZNGLSIEGWQEIB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine?
The IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine (CID 3401968) is 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine.
What is the SMILES notation for 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine?
The canonical SMILES for 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine is Cc1cc(C)nc(-n2nc(C)cc2C)n1.
What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine?
The InChIKey is HZNGLSIEGWQEIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c1-7-5-8(2)13-11(12-7)15-10(4)6-9(3)14-15/h5-6H,1-4H3.
What are the key properties of 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine?
2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine has a molecular weight of 202.26 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylpyrazol-1-yl)-4,6-dimethylpyrimidine is sourced from PubChem (CID 3401968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).