C17H18FNO — CID 3404384
7-ethyl-2-(3-fluoro-4-methoxyphenyl)-2,3-dihydro-1H-indole (PubChem CID 3404384) has the molecular formula C17H18FNO and a molecular weight of 271.34 g/mol. Its IUPAC name is 7-ethyl-2-(3-fluoro-4-methoxyphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 7-ethyl-2-(3-fluoro-4-methoxyphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 3404384 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 7-ethyl-2-(3-fluoro-4-methoxyphenyl)-2,3-dihydro-1H-indole |
| SMILES | CCc1cccc2c1NC(c1ccc(OC)c(F)c1)C2 |
| InChI | InChI=1S/C17H18FNO/c1-3-11-5-4-6-13-10-15(19-17(11)13)12-7-8-16(20-2)14(18)9-12/h4-9,15,19H,3,10H2,1-2H3 |
| InChIKey | GWMSXTBAFWWOLI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |