C15H19FO2 — CID 81415947
2,2-diethyl-3-(3-fluoro-4-methoxyphenyl)cyclobutan-1-one (PubChem CID 81415947) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is 2,2-diethyl-3-(3-fluoro-4-methoxyphenyl)cyclobutan-1-one.
| Compound Name | 2,2-diethyl-3-(3-fluoro-4-methoxyphenyl)cyclobutan-1-one |
|---|---|
| PubChem CID | 81415947 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2,2-diethyl-3-(3-fluoro-4-methoxyphenyl)cyclobutan-1-one |
| SMILES | CCC1(CC)C(=O)CC1c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C15H19FO2/c1-4-15(5-2)11(9-14(15)17)10-6-7-13(18-3)12(16)8-10/h6-8,11H,4-5,9H2,1-3H3 |
| InChIKey | DJJHPNDWQOQWJQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |