About 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene
4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene (PubChem CID 165178047) has the molecular formula C12H15FO
and a molecular weight of 194.25 g/mol. Its IUPAC name is 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene.
Analyze 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene?
The IUPAC name of 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene (CID 165178047) is 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene.
What is the SMILES notation for 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene?
The canonical SMILES for 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene is COc1ccc(C2CC2(C)C)cc1F.
What is the InChIKey of 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene?
The InChIKey is MWQIOGLZHVHZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO/c1-12(2)7-9(12)8-4-5-11(14-3)10(13)6-8/h4-6,9H,7H2,1-3H3.
What are the key properties of 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene?
4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene has a molecular weight of 194.25 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylcyclopropyl)-2-fluoro-1-methoxybenzene is sourced from PubChem (CID 165178047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).