C21H22O6S — CID 3404857
(3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) benzenesulfonate (PubChem CID 3404857) has the molecular formula C21H22O6S and a molecular weight of 402.47 g/mol. Its IUPAC name is (3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) benzenesulfonate.
| Compound Name | (3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) benzenesulfonate |
|---|---|
| PubChem CID | 3404857 |
| Molecular Formula | C21H22O6S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) benzenesulfonate |
| SMILES | CC1=CC(=O)C2=C(C)CC(OS(=O)(=O)c3ccccc3)C3C(C)C(=O)OC3C12 |
| InChI | InChI=1S/C21H22O6S/c1-11-9-15(22)17-12(2)10-16(19-13(3)21(23)26-20(19)18(11)17)27-28(24,25)14-7-5-4-6-8-14/h4-9,13,16,18-20H,10H2,1-3H3 |
| InChIKey | JNNHWIKHVVSJOP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|