C29H28O5 — CID 3792706
(3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2,2-diphenylacetate (PubChem CID 3792706) has the molecular formula C29H28O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is (3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2,2-diphenylacetate.
| Compound Name | (3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2,2-diphenylacetate |
|---|---|
| PubChem CID | 3792706 |
| Molecular Formula | C29H28O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2,2-diphenylacetate |
| SMILES | CC1=CC(=O)C2=C(C)CC(OC(=O)C(c3ccccc3)c3ccccc3)C3C(C)C(=O)OC3C12 |
| InChI | InChI=1S/C29H28O5/c1-16-14-21(30)23-17(2)15-22(25-18(3)28(31)34-27(25)24(16)23)33-29(32)26(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-14,18,22,24-27H,15H2,1-3H3 |
| InChIKey | IFLXJELWZXSTOM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |