C17H19ClO5 — CID 86809360
[(3S,4S,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-chloroacetate (PubChem CID 86809360) has the molecular formula C17H19ClO5 and a molecular weight of 338.79 g/mol. Its IUPAC name is [(3S,4S,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-chloroacetate.
| Compound Name | [(3S,4S,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 86809360 |
| Molecular Formula | C17H19ClO5 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [(3S,4S,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2-chloroacetate |
| SMILES | CC1=CC(=O)C2=C(C)C[C@H](OC(=O)CCl)C3C(C)C(=O)O[C@@H]3C12 |
| InChI | InChI=1S/C17H19ClO5/c1-7-4-10(19)13-8(2)5-11(22-12(20)6-18)15-9(3)17(21)23-16(15)14(7)13/h4,9,11,14-16H,5-6H2,1-3H3/t9?,11-,14?,15?,16+/m0/s1 |
| InChIKey | NWASYGSCEIZROR-AAAQJUCPSA-N |
| XLogP | 2.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|