C17H17Cl3O5 — CID 11873813
[(3S,3aR,4S,9aS,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2,2,2-trichloroacetate (PubChem CID 11873813) has the molecular formula C17H17Cl3O5 and a molecular weight of 407.68 g/mol. Its IUPAC name is [(3S,3aR,4S,9aS,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2,2,2-trichloroacetate.
| Compound Name | [(3S,3aR,4S,9aS,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 11873813 |
| Molecular Formula | C17H17Cl3O5 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | [(3S,3aR,4S,9aS,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] 2,2,2-trichloroacetate |
| SMILES | CC1=CC(=O)C2=C(C)C[C@H](OC(=O)C(Cl)(Cl)Cl)[C@@H]3[C@H](OC(=O)[C@H]3C)[C@@H]12 |
| InChI | InChI=1S/C17H17Cl3O5/c1-6-4-9(21)11-7(2)5-10(24-16(23)17(18,19)20)13-8(3)15(22)25-14(13)12(6)11/h4,8,10,12-14H,5H2,1-3H3/t8-,10-,12-,13+,14+/m0/s1 |
| InChIKey | XJZDWBGISVLGDS-XUNJKSNWSA-N |
| XLogP | 3.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|