C21H25NO2 — CID 1418153
[(1R,2R)-2-(dimethylamino)cyclopentyl] 2,2-diphenylacetate (PubChem CID 1418153) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is [(1R,2R)-2-(dimethylamino)cyclopentyl] 2,2-diphenylacetate.
| Compound Name | [(1R,2R)-2-(dimethylamino)cyclopentyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 1418153 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | [(1R,2R)-2-(dimethylamino)cyclopentyl] 2,2-diphenylacetate |
| SMILES | CN(C)[C@@H]1CCC[C@H]1OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-22(2)18-14-9-15-19(18)24-21(23)20(16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18-20H,9,14-15H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | KWBLUDBBNZTNOA-RTBURBONSA-N |
| XLogP | 3.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |