C24H31NO2 — CID 24837144
[2-[(dimethylamino)methyl]-1-methylcyclohexyl] 2,2-diphenylacetate (PubChem CID 24837144) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]-1-methylcyclohexyl] 2,2-diphenylacetate.
| Compound Name | [2-[(dimethylamino)methyl]-1-methylcyclohexyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 24837144 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | [2-[(dimethylamino)methyl]-1-methylcyclohexyl] 2,2-diphenylacetate |
| SMILES | CN(C)CC1CCCCC1(C)OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-24(17-11-10-16-21(24)18-25(2)3)27-23(26)22(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15,21-22H,10-11,16-18H2,1-3H3 |
| InChIKey | VFDQIKUIPJBJQA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |