C20H32ClNO2 — CID 24837151
[2-[(dimethylamino)methyl]-1-propylcyclohexyl] 2-phenylacetate;hydrochloride (PubChem CID 24837151) has the molecular formula C20H32ClNO2 and a molecular weight of 353.93 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]-1-propylcyclohexyl] 2-phenylacetate;hydrochloride.
| Compound Name | [2-[(dimethylamino)methyl]-1-propylcyclohexyl] 2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 24837151 |
| Molecular Formula | C20H32ClNO2 |
| Molecular Weight | 353.93 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | [2-[(dimethylamino)methyl]-1-propylcyclohexyl] 2-phenylacetate;hydrochloride |
| SMILES | CCCC1(OC(=O)Cc2ccccc2)CCCCC1CN(C)C.Cl |
| InChI | InChI=1S/C20H31NO2.ClH/c1-4-13-20(14-9-8-12-18(20)16-21(2)3)23-19(22)15-17-10-6-5-7-11-17;/h5-7,10-11,18H,4,8-9,12-16H2,1-3H3;1H |
| InChIKey | JWWHDDKVYNOAJR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.93 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |