C21H31NO2 — CID 24837148
[2-[(dimethylamino)methyl]-1-propylcyclohexyl] (Z)-3-phenylprop-2-enoate (PubChem CID 24837148) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]-1-propylcyclohexyl] (Z)-3-phenylprop-2-enoate.
| Compound Name | [2-[(dimethylamino)methyl]-1-propylcyclohexyl] (Z)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 24837148 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | [2-[(dimethylamino)methyl]-1-propylcyclohexyl] (Z)-3-phenylprop-2-enoate |
| SMILES | CCCC1(OC(=O)/C=C\c2ccccc2)CCCCC1CN(C)C |
| InChI | InChI=1S/C21H31NO2/c1-4-15-21(16-9-8-12-19(21)17-22(2)3)24-20(23)14-13-18-10-6-5-7-11-18/h5-7,10-11,13-14,19H,4,8-9,12,15-17H2,1-3H3/b14-13- |
| InChIKey | WMGGAXLQUFIKGM-YPKPFQOOSA-N |
| XLogP | 4.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|