C19H28ClNO3 — CID 91941951
[2-[(dimethylamino)methyl]cyclohexyl] 3-(4-methoxyphenyl)prop-2-enoate;hydrochloride (PubChem CID 91941951) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]cyclohexyl] 3-(4-methoxyphenyl)prop-2-enoate;hydrochloride.
| Compound Name | [2-[(dimethylamino)methyl]cyclohexyl] 3-(4-methoxyphenyl)prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 91941951 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | [2-[(dimethylamino)methyl]cyclohexyl] 3-(4-methoxyphenyl)prop-2-enoate;hydrochloride |
| SMILES | COc1ccc(C=CC(=O)OC2CCCCC2CN(C)C)cc1.Cl |
| InChI | InChI=1S/C19H27NO3.ClH/c1-20(2)14-16-6-4-5-7-18(16)23-19(21)13-10-15-8-11-17(22-3)12-9-15;/h8-13,16,18H,4-7,14H2,1-3H3;1H |
| InChIKey | FJKRVXLDYFNYIO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|