C17H18F2N2O6S2 — CID 34055693
2-[[4-(difluoromethylsulfonyl)phenyl]sulfonyl-methylamino]-N-(3-methoxyphenyl)acetamide (PubChem CID 34055693) has the molecular formula C17H18F2N2O6S2 and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-[[4-(difluoromethylsulfonyl)phenyl]sulfonyl-methylamino]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[[4-(difluoromethylsulfonyl)phenyl]sulfonyl-methylamino]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 34055693 |
| Molecular Formula | C17H18F2N2O6S2 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-[[4-(difluoromethylsulfonyl)phenyl]sulfonyl-methylamino]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN(C)S(=O)(=O)c2ccc(S(=O)(=O)C(F)F)cc2)c1 |
| InChI | InChI=1S/C17H18F2N2O6S2/c1-21(11-16(22)20-12-4-3-5-13(10-12)27-2)29(25,26)15-8-6-14(7-9-15)28(23,24)17(18)19/h3-10,17H,11H2,1-2H3,(H,20,22) |
| InChIKey | QXLRMUFDIUWRLF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |