C18H25N5O3S — CID 34060766
(2R,6R)-2,6-dimethyl-4-(4-quinazolin-4-ylpiperazin-1-yl)sulfonylmorpholine (PubChem CID 34060766) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-(4-quinazolin-4-ylpiperazin-1-yl)sulfonylmorpholine.
| Compound Name | (2R,6R)-2,6-dimethyl-4-(4-quinazolin-4-ylpiperazin-1-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 34060766 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-(4-quinazolin-4-ylpiperazin-1-yl)sulfonylmorpholine |
| SMILES | C[C@@H]1CN(S(=O)(=O)N2CCN(c3ncnc4ccccc34)CC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H25N5O3S/c1-14-11-23(12-15(2)26-14)27(24,25)22-9-7-21(8-10-22)18-16-5-3-4-6-17(16)19-13-20-18/h3-6,13-15H,7-12H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | QQSYIMGGAGWRIU-HUUCEWRRSA-N |
| XLogP | 1.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |