C21H15F2N3O2S — CID 34075971
(E)-3-(3-fluoro-4-methoxyphenyl)-N-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enamide (PubChem CID 34075971) has the molecular formula C21H15F2N3O2S and a molecular weight of 411.43 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-N-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 34075971 |
| Molecular Formula | C21H15F2N3O2S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2c(-c3ccc(F)cc3)nc3sccn23)cc1F |
| InChI | InChI=1S/C21H15F2N3O2S/c1-28-17-8-2-13(12-16(17)23)3-9-18(27)24-20-19(14-4-6-15(22)7-5-14)25-21-26(20)10-11-29-21/h2-12H,1H3,(H,24,27)/b9-3+ |
| InChIKey | RINRNWBOMOBZAN-YCRREMRBSA-N |
| XLogP | 5.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|