About Nicomol
Nicomol (PubChem CID 34081) has the molecular formula C34H32N4O9
and a molecular weight of 640.60 g/mol. Its IUPAC name is [2-hydroxy-1,3,3-tris(pyridine-3-carbonyloxymethyl)cyclohexyl]methyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | Nicomol |
| PubChem CID | 34081 |
| Molecular Formula | C34H32N4O9 |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | [2-hydroxy-1,3,3-tris(pyridine-3-carbonyloxymethyl)cyclohexyl]methyl pyridine-3-carboxylate |
| SMILES | C1CC(C(C(C1)(COC(=O)C2=CN=CC=C2)COC(=O)C3=CN=CC=C3)O)(COC(=O)C4=CN=CC=C4)COC(=O)C5=CN=CC=C5 |
| InChI | InChI=1S/C34H32N4O9/c39-28(24-6-1-12-35-16-24)44-20-33(21-45-29(40)25-7-2-13-36-17-25)10-5-11-34(32(33)43,22-46-30(41)26-8-3-14-37-18-26)23-47-31(42)27-9-4-15-38-19-27/h1-4,6-9,12-19,32,43H,5,10-11,20-23H2 |
| InChIKey | VRAHPESAMYMDQI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | 926 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze Nicomol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Nicomol?
The IUPAC name of Nicomol (CID 34081) is [2-hydroxy-1,3,3-tris(pyridine-3-carbonyloxymethyl)cyclohexyl]methyl pyridine-3-carboxylate.
What is the SMILES notation for Nicomol?
The canonical SMILES for Nicomol is C1CC(C(C(C1)(COC(=O)C2=CN=CC=C2)COC(=O)C3=CN=CC=C3)O)(COC(=O)C4=CN=CC=C4)COC(=O)C5=CN=CC=C5.
What is the InChIKey of Nicomol?
The InChIKey is VRAHPESAMYMDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H32N4O9/c39-28(24-6-1-12-35-16-24)44-20-33(21-45-29(40)25-7-2-13-36-17-25)10-5-11-34(32(33)43,22-46-30(41)26-8-3-14-37-18-26)23-47-31(42)27-9-4-15-38-19-27/h1-4,6-9,12-19,32,43H,5,10-11,20-23H2.
What are the key properties of Nicomol?
Nicomol has a molecular weight of 640.60 g/mol, XLogP of 2.80, 16 rotatable bonds, 1 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for Nicomol is sourced from PubChem (CID 34081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).