C16H30N6 — CID 3408909
1-[(1-tert-butyltetrazol-5-yl)methyl]-4-cyclohexylpiperazine (PubChem CID 3408909) has the molecular formula C16H30N6 and a molecular weight of 306.46 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)methyl]-4-cyclohexylpiperazine.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)methyl]-4-cyclohexylpiperazine |
|---|---|
| PubChem CID | 3408909 |
| Molecular Formula | C16H30N6 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)methyl]-4-cyclohexylpiperazine |
| SMILES | CC(C)(C)n1nnnc1CN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H30N6/c1-16(2,3)22-15(17-18-19-22)13-20-9-11-21(12-10-20)14-7-5-4-6-8-14/h14H,4-13H2,1-3H3 |
| InChIKey | VIQNNBAOFHHTRC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |