C14H15ClN2O5 — CID 3408913
ethyl 5-[[4-chloro-2-(hydroxyiminomethyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 3408913) has the molecular formula C14H15ClN2O5 and a molecular weight of 326.74 g/mol. Its IUPAC name is ethyl 5-[[4-chloro-2-(hydroxyiminomethyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[[4-chloro-2-(hydroxyiminomethyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 3408913 |
| Molecular Formula | C14H15ClN2O5 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | ethyl 5-[[4-chloro-2-(hydroxyiminomethyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC(COc2ccc(Cl)cc2C=NO)C1 |
| InChI | InChI=1S/C14H15ClN2O5/c1-2-20-14(18)12-6-11(22-17-12)8-21-13-4-3-10(15)5-9(13)7-16-19/h3-5,7,11,19H,2,6,8H2,1H3 |
| InChIKey | YBEXMVBQSQLANY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|