C17H21N3O3 — CID 3410520
N-[4-(2-oxopyrrolidin-1-yl)benzoyl]piperidine-4-carboxamide (PubChem CID 3410520) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[4-(2-oxopyrrolidin-1-yl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(2-oxopyrrolidin-1-yl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3410520 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[4-(2-oxopyrrolidin-1-yl)benzoyl]piperidine-4-carboxamide |
| SMILES | O=C(NC(=O)C1CCNCC1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C17H21N3O3/c21-15-2-1-11-20(15)14-5-3-12(4-6-14)16(22)19-17(23)13-7-9-18-10-8-13/h3-6,13,18H,1-2,7-11H2,(H,19,22,23) |
| InChIKey | BFCZTEJOJHAAOU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|