C18H16ClN3O3 — CID 34106710
(6-chloro-3-pyridinyl)methyl 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate (PubChem CID 34106710) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate |
|---|---|
| PubChem CID | 34106710 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate |
| SMILES | Cc1cccc2c(=O)n(CCC(=O)OCc3ccc(Cl)nc3)cnc12 |
| InChI | InChI=1S/C18H16ClN3O3/c1-12-3-2-4-14-17(12)21-11-22(18(14)24)8-7-16(23)25-10-13-5-6-15(19)20-9-13/h2-6,9,11H,7-8,10H2,1H3 |
| InChIKey | MONODAVFDVRBCN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|