C23H20N2O4 — CID 55554777
(6-methoxynaphthalen-2-yl)methyl 2-(8-methyl-4-oxoquinazolin-3-yl)acetate (PubChem CID 55554777) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is (6-methoxynaphthalen-2-yl)methyl 2-(8-methyl-4-oxoquinazolin-3-yl)acetate.
| Compound Name | (6-methoxynaphthalen-2-yl)methyl 2-(8-methyl-4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 55554777 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (6-methoxynaphthalen-2-yl)methyl 2-(8-methyl-4-oxoquinazolin-3-yl)acetate |
| SMILES | COc1ccc2cc(COC(=O)Cn3cnc4c(C)cccc4c3=O)ccc2c1 |
| InChI | InChI=1S/C23H20N2O4/c1-15-4-3-5-20-22(15)24-14-25(23(20)27)12-21(26)29-13-16-6-7-18-11-19(28-2)9-8-17(18)10-16/h3-11,14H,12-13H2,1-2H3 |
| InChIKey | KDPYBYJXMBPRON-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |