C21H26N2O3S — CID 3410685
6-tert-butyl-2-[3-(5-methylfuran-2-yl)prop-2-enoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3410685) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 6-tert-butyl-2-[3-(5-methylfuran-2-yl)prop-2-enoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-2-[3-(5-methylfuran-2-yl)prop-2-enoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3410685 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 6-tert-butyl-2-[3-(5-methylfuran-2-yl)prop-2-enoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2sc3c(c2C(N)=O)CCC(C(C)(C)C)C3)o1 |
| InChI | InChI=1S/C21H26N2O3S/c1-12-5-7-14(26-12)8-10-17(24)23-20-18(19(22)25)15-9-6-13(21(2,3)4)11-16(15)27-20/h5,7-8,10,13H,6,9,11H2,1-4H3,(H2,22,25)(H,23,24) |
| InChIKey | TYSQHPHGKYEHIA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|